C12H14N2O2 — CID 107578950
[3-(4-hydroxybut-1-ynyl)-5-methylphenyl]urea (PubChem CID 107578950) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is [3-(4-hydroxybut-1-ynyl)-5-methylphenyl]urea.
| Compound Name | [3-(4-hydroxybut-1-ynyl)-5-methylphenyl]urea |
|---|---|
| PubChem CID | 107578950 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | [3-(4-hydroxybut-1-ynyl)-5-methylphenyl]urea |
| SMILES | Cc1cc(C#CCCO)cc(NC(N)=O)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-9-6-10(4-2-3-5-15)8-11(7-9)14-12(13)16/h6-8,15H,3,5H2,1H3,(H3,13,14,16) |
| InChIKey | HCHZYJZDFMSLNP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|