C15H19NO2 — CID 115999769
3-(4-hydroxybut-1-ynyl)-5-methyl-N-propan-2-ylbenzamide (PubChem CID 115999769) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-5-methyl-N-propan-2-ylbenzamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-5-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 115999769 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-5-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1cc(C#CCCO)cc(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C15H19NO2/c1-11(2)16-15(18)14-9-12(3)8-13(10-14)6-4-5-7-17/h8-11,17H,5,7H2,1-3H3,(H,16,18) |
| InChIKey | VVZGMLDKNFVFKD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|