C14H16FNO2 — CID 60816110
2-fluoro-4-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzamide (PubChem CID 60816110) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzamide.
| Compound Name | 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 60816110 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(C#CCCO)cc1F |
| InChI | InChI=1S/C14H16FNO2/c1-10(2)16-14(18)12-7-6-11(9-13(12)15)5-3-4-8-17/h6-7,9-10,17H,4,8H2,1-2H3,(H,16,18) |
| InChIKey | TYEULXXUKKXNJK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|