C14H15FN2O3 — CID 60821325
2-fluoro-4-(4-hydroxybut-1-ynyl)-N-[2-(methylamino)-2-oxoethyl]benzamide (PubChem CID 60821325) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-[2-(methylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-[2-(methylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 60821325 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-fluoro-4-(4-hydroxybut-1-ynyl)-N-[2-(methylamino)-2-oxoethyl]benzamide |
| SMILES | CNC(=O)CNC(=O)c1ccc(C#CCCO)cc1F |
| InChI | InChI=1S/C14H15FN2O3/c1-16-13(19)9-17-14(20)11-6-5-10(8-12(11)15)4-2-3-7-18/h5-6,8,18H,3,7,9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | GGNWRPBHTZPACV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|