C11H14N2O3S — CID 114959491
1-(4-hydroxybut-1-ynyl)-3-[(sulfamoylamino)methyl]benzene (PubChem CID 114959491) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-(4-hydroxybut-1-ynyl)-3-[(sulfamoylamino)methyl]benzene.
| Compound Name | 1-(4-hydroxybut-1-ynyl)-3-[(sulfamoylamino)methyl]benzene |
|---|---|
| PubChem CID | 114959491 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(4-hydroxybut-1-ynyl)-3-[(sulfamoylamino)methyl]benzene |
| SMILES | NS(=O)(=O)NCc1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C11H14N2O3S/c12-17(15,16)13-9-11-6-3-5-10(8-11)4-1-2-7-14/h3,5-6,8,13-14H,2,7,9H2,(H2,12,15,16) |
| InChIKey | SKYCDPBYYDSTQS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|