C11H13NO3S — CID 60824271
3-(4-hydroxybut-1-ynyl)-N-methylbenzenesulfonamide (PubChem CID 60824271) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60824271 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C11H13NO3S/c1-12-16(14,15)11-7-4-6-10(9-11)5-2-3-8-13/h4,6-7,9,12-13H,3,8H2,1H3 |
| InChIKey | NRDJNCCFSIZNAH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|