C12H11N3O3S2 — CID 114913905
3-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide (PubChem CID 114913905) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114913905 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnns1)c1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C12H11N3O3S2/c16-7-2-1-4-10-5-3-6-11(8-10)20(17,18)14-12-9-13-15-19-12/h3,5-6,8-9,14,16H,2,7H2 |
| InChIKey | QULUTDDYRVGPQI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|