C11H10N4O3S2 — CID 114913929
3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)benzenesulfonamide (PubChem CID 114913929) has the molecular formula C11H10N4O3S2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)benzenesulfonamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114913929 |
| Molecular Formula | C11H10N4O3S2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nnns1)c1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C11H10N4O3S2/c16-7-2-1-4-9-5-3-6-10(8-9)20(17,18)13-11-12-14-15-19-11/h3,5-6,8,16H,2,7H2,(H,12,13,15) |
| InChIKey | MOPCIEMAZUAXGK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|