C14H18N2O4S — CID 61466477
2-[[3-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N-methylpropanamide (PubChem CID 61466477) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[[3-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N-methylpropanamide.
| Compound Name | 2-[[3-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61466477 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[[3-(4-hydroxybut-1-ynyl)phenyl]sulfonylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NS(=O)(=O)c1cccc(C#CCCO)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-11(14(18)15-2)16-21(19,20)13-8-5-7-12(10-13)6-3-4-9-17/h5,7-8,10-11,16-17H,4,9H2,1-2H3,(H,15,18) |
| InChIKey | IEIYDGZFMNOALB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|