C13H16ClN3O3S — CID 61466088
2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonylamino]-N-methylpropanamide (PubChem CID 61466088) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonylamino]-N-methylpropanamide.
| Compound Name | 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61466088 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonylamino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NS(=O)(=O)c1ccc(C#CCN)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O3S/c1-9(13(18)16-2)17-21(19,20)12-6-5-10(4-3-7-15)8-11(12)14/h5-6,8-9,17H,7,15H2,1-2H3,(H,16,18) |
| InChIKey | MSMWLBKMWKOHCQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|