C13H16ClN3O3S — CID 60846042
2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonyl-methylamino]-N-methylacetamide (PubChem CID 60846042) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonyl-methylamino]-N-methylacetamide.
| Compound Name | 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonyl-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 60846042 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[[4-(3-aminoprop-1-ynyl)-2-chlorophenyl]sulfonyl-methylamino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C)S(=O)(=O)c1ccc(C#CCN)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O3S/c1-16-13(18)9-17(2)21(19,20)12-6-5-10(4-3-7-15)8-11(12)14/h5-6,8H,7,9,15H2,1-2H3,(H,16,18) |
| InChIKey | LWNNDVDWUBEXSS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|