C14H23N3O3S — CID 61465866
N-methyl-2-[[3-[1-(methylamino)propyl]phenyl]sulfonylamino]propanamide (PubChem CID 61465866) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-methyl-2-[[3-[1-(methylamino)propyl]phenyl]sulfonylamino]propanamide.
| Compound Name | N-methyl-2-[[3-[1-(methylamino)propyl]phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 61465866 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-methyl-2-[[3-[1-(methylamino)propyl]phenyl]sulfonylamino]propanamide |
| SMILES | CCC(NC)c1cccc(S(=O)(=O)NC(C)C(=O)NC)c1 |
| InChI | InChI=1S/C14H23N3O3S/c1-5-13(15-3)11-7-6-8-12(9-11)21(19,20)17-10(2)14(18)16-4/h6-10,13,15,17H,5H2,1-4H3,(H,16,18) |
| InChIKey | PBDPJDVFFVDUFF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |