C14H22N2O4S — CID 61499264
ethyl 2-[[3-(1-aminopropyl)phenyl]sulfonylamino]propanoate (PubChem CID 61499264) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is ethyl 2-[[3-(1-aminopropyl)phenyl]sulfonylamino]propanoate.
| Compound Name | ethyl 2-[[3-(1-aminopropyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 61499264 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 2-[[3-(1-aminopropyl)phenyl]sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NS(=O)(=O)c1cccc(C(N)CC)c1 |
| InChI | InChI=1S/C14H22N2O4S/c1-4-13(15)11-7-6-8-12(9-11)21(18,19)16-10(3)14(17)20-5-2/h6-10,13,16H,4-5,15H2,1-3H3 |
| InChIKey | URNPCHUHZJYZHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |