C13H16N2O4S — CID 106833128
ethyl 2-[(4-cyano-3-methylphenyl)sulfonylamino]propanoate (PubChem CID 106833128) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is ethyl 2-[(4-cyano-3-methylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 2-[(4-cyano-3-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 106833128 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | ethyl 2-[(4-cyano-3-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NS(=O)(=O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-4-19-13(16)10(3)15-20(17,18)12-6-5-11(8-14)9(2)7-12/h5-7,10,15H,4H2,1-3H3 |
| InChIKey | OPYKMFXDBLMIDP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |