C13H16N2O4S2 — CID 106831491
(2S)-2-[(4-cyano-3-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 106831491) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S)-2-[(4-cyano-3-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(4-cyano-3-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 106831491 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (2S)-2-[(4-cyano-3-methylphenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NS(=O)(=O)c1ccc(C#N)c(C)c1)C(=O)O |
| InChI | InChI=1S/C13H16N2O4S2/c1-9-7-11(4-3-10(9)8-14)21(18,19)15-12(13(16)17)5-6-20-2/h3-4,7,12,15H,5-6H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | VGEUDMSGYMJSPX-LBPRGKRZSA-N |
| XLogP | 1.35 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |