C11H14BrNO4S2 — CID 43084186
2-[(3-bromophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 43084186) has the molecular formula C11H14BrNO4S2 and a molecular weight of 368.27 g/mol. Its IUPAC name is 2-[(3-bromophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(3-bromophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43084186 |
| Molecular Formula | C11H14BrNO4S2 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2-[(3-bromophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C11H14BrNO4S2/c1-18-6-5-10(11(14)15)13-19(16,17)9-4-2-3-8(12)7-9/h2-4,7,10,13H,5-6H2,1H3,(H,14,15) |
| InChIKey | FXBCIGRTMZLNCG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |