C14H18BrNO6S — CID 90926104
(2S)-2-[(3-bromophenyl)sulfonylamino]octanedioic acid (PubChem CID 90926104) has the molecular formula C14H18BrNO6S and a molecular weight of 408.27 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)sulfonylamino]octanedioic acid.
| Compound Name | (2S)-2-[(3-bromophenyl)sulfonylamino]octanedioic acid |
|---|---|
| PubChem CID | 90926104 |
| Molecular Formula | C14H18BrNO6S |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)sulfonylamino]octanedioic acid |
| SMILES | O=C(O)CCCCC[C@H](NS(=O)(=O)c1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H18BrNO6S/c15-10-5-4-6-11(9-10)23(21,22)16-12(14(19)20)7-2-1-3-8-13(17)18/h4-6,9,12,16H,1-3,7-8H2,(H,17,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | NVWNLDURKFRBLS-LBPRGKRZSA-N |
| XLogP | 2.22 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|