C18H27NO6S — CID 140522092
(2S)-2-[(4-tert-butylphenyl)sulfonylamino]octanedioic acid (PubChem CID 140522092) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylphenyl)sulfonylamino]octanedioic acid.
| Compound Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]octanedioic acid |
|---|---|
| PubChem CID | 140522092 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S)-2-[(4-tert-butylphenyl)sulfonylamino]octanedioic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N[C@@H](CCCCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H27NO6S/c1-18(2,3)13-9-11-14(12-10-13)26(24,25)19-15(17(22)23)7-5-4-6-8-16(20)21/h9-12,15,19H,4-8H2,1-3H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | HONVNVIOONJVLM-HNNXBMFYSA-N |
| XLogP | 2.75 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|