C11H12BrNO6S — CID 25198912
(2S)-2-[(4-bromophenyl)sulfonylamino]pentanedioic acid (PubChem CID 25198912) has the molecular formula C11H12BrNO6S and a molecular weight of 366.19 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(4-bromophenyl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 25198912 |
| Molecular Formula | C11H12BrNO6S |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)sulfonylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C11H12BrNO6S/c12-7-1-3-8(4-2-7)20(18,19)13-9(11(16)17)5-6-10(14)15/h1-4,9,13H,5-6H2,(H,14,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | CYMGKIYLVZCIJI-VIFPVBQESA-N |
| XLogP | 1.05 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |