C12H14BrNO6S — CID 104936115
(2R)-2-[(4-bromophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 104936115) has the molecular formula C12H14BrNO6S and a molecular weight of 380.22 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 104936115 |
| Molecular Formula | C12H14BrNO6S |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C12H14BrNO6S/c1-20-11(15)7-6-10(12(16)17)14-21(18,19)9-4-2-8(13)3-5-9/h2-5,10,14H,6-7H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | ZHCIAXUORNWJEP-SNVBAGLBSA-N |
| XLogP | 1.13 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |