C11H12N2O6S2 — CID 106265938
(2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 106265938) has the molecular formula C11H12N2O6S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106265938 |
| Molecular Formula | C11H12N2O6S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (2S)-2-[(5-cyanothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NS(=O)(=O)c1ccc(C#N)s1)C(=O)O |
| InChI | InChI=1S/C11H12N2O6S2/c1-19-9(14)4-3-8(11(15)16)13-21(17,18)10-5-2-7(6-12)20-10/h2,5,8,13H,3-4H2,1H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | VMIUWAUGMLQEFM-QMMMGPOBSA-N |
| XLogP | 0.30 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |