C10H12BrNO6S2 — CID 104935678
(2S)-2-[(5-bromothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid (PubChem CID 104935678) has the molecular formula C10H12BrNO6S2 and a molecular weight of 386.25 g/mol. Its IUPAC name is (2S)-2-[(5-bromothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(5-bromothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 104935678 |
| Molecular Formula | C10H12BrNO6S2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | (2S)-2-[(5-bromothiophen-2-yl)sulfonylamino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NS(=O)(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H12BrNO6S2/c1-18-8(13)4-2-6(10(14)15)12-20(16,17)9-5-3-7(11)19-9/h3,5-6,12H,2,4H2,1H3,(H,14,15)/t6-/m0/s1 |
| InChIKey | LEMWZMFYARIRJT-LURJTMIESA-N |
| XLogP | 1.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |