C10H13NO6S2 — CID 61145094
(2S)-2-[(5-methylthiophen-2-yl)sulfonylamino]pentanedioic acid (PubChem CID 61145094) has the molecular formula C10H13NO6S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S)-2-[(5-methylthiophen-2-yl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(5-methylthiophen-2-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61145094 |
| Molecular Formula | C10H13NO6S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2S)-2-[(5-methylthiophen-2-yl)sulfonylamino]pentanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)O)s1 |
| InChI | InChI=1S/C10H13NO6S2/c1-6-2-5-9(18-6)19(16,17)11-7(10(14)15)3-4-8(12)13/h2,5,7,11H,3-4H2,1H3,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | BTYSIUIJOBYJHN-ZETCQYMHSA-N |
| XLogP | 0.65 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |