C10H12ClNO6S2 — CID 103099643
2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pentanedioic acid (PubChem CID 103099643) has the molecular formula C10H12ClNO6S2 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pentanedioic acid.
| Compound Name | 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 103099643 |
| Molecular Formula | C10H12ClNO6S2 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pentanedioic acid |
| SMILES | Cc1cc(S(=O)(=O)NC(CCC(=O)O)C(=O)O)sc1Cl |
| InChI | InChI=1S/C10H12ClNO6S2/c1-5-4-8(19-9(5)11)20(17,18)12-6(10(15)16)2-3-7(13)14/h4,6,12H,2-3H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | AZNKKVAJKWYFNJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |