C11H14ClNO6S2 — CID 107266601
(2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]hexanedioic acid (PubChem CID 107266601) has the molecular formula C11H14ClNO6S2 and a molecular weight of 355.82 g/mol. Its IUPAC name is (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]hexanedioic acid.
| Compound Name | (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]hexanedioic acid |
|---|---|
| PubChem CID | 107266601 |
| Molecular Formula | C11H14ClNO6S2 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2R)-2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]hexanedioic acid |
| SMILES | Cc1cc(S(=O)(=O)N[C@H](CCCC(=O)O)C(=O)O)sc1Cl |
| InChI | InChI=1S/C11H14ClNO6S2/c1-6-5-9(20-10(6)12)21(18,19)13-7(11(16)17)3-2-4-8(14)15/h5,7,13H,2-4H2,1H3,(H,14,15)(H,16,17)/t7-/m1/s1 |
| InChIKey | WIYYRQCOHQOHSR-SSDOTTSWSA-N |
| XLogP | 1.70 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |