C8H10ClNO4S2 — CID 103099583
3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoic acid (PubChem CID 103099583) has the molecular formula C8H10ClNO4S2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 103099583 |
| Molecular Formula | C8H10ClNO4S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]propanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCCC(=O)O)sc1Cl |
| InChI | InChI=1S/C8H10ClNO4S2/c1-5-4-7(15-8(5)9)16(13,14)10-3-2-6(11)12/h4,10H,2-3H2,1H3,(H,11,12) |
| InChIKey | SXUMTBGTSRKOLY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |