C9H13BrClNO2S2 — CID 106846774
N-(4-bromobutyl)-5-chloro-4-methylthiophene-2-sulfonamide (PubChem CID 106846774) has the molecular formula C9H13BrClNO2S2 and a molecular weight of 346.70 g/mol. Its IUPAC name is N-(4-bromobutyl)-5-chloro-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(4-bromobutyl)-5-chloro-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106846774 |
| Molecular Formula | C9H13BrClNO2S2 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 344.93 |
| IUPAC Name | N-(4-bromobutyl)-5-chloro-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCCBr)sc1Cl |
| InChI | InChI=1S/C9H13BrClNO2S2/c1-7-6-8(15-9(7)11)16(13,14)12-5-3-2-4-10/h6,12H,2-5H2,1H3 |
| InChIKey | XWPVCSPDYRKRNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|