C10H17ClN2O3S2 — CID 103100525
5-chloro-N-[2-(2-methoxyethylamino)ethyl]-4-methylthiophene-2-sulfonamide (PubChem CID 103100525) has the molecular formula C10H17ClN2O3S2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100525 |
| Molecular Formula | C10H17ClN2O3S2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-4-methylthiophene-2-sulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C10H17ClN2O3S2/c1-8-7-9(17-10(8)11)18(14,15)13-4-3-12-5-6-16-2/h7,12-13H,3-6H2,1-2H3 |
| InChIKey | HSUVECJXNYHSFI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|