C9H12ClNO5S2 — CID 103215118
(2S)-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 103215118) has the molecular formula C9H12ClNO5S2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2S)-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103215118 |
| Molecular Formula | C9H12ClNO5S2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | (2S)-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCC[C@H](O)C(=O)O)sc1Cl |
| InChI | InChI=1S/C9H12ClNO5S2/c1-5-4-7(17-8(5)10)18(15,16)11-3-2-6(12)9(13)14/h4,6,11-12H,2-3H2,1H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | KNANORNJWDNJFN-LURJTMIESA-N |
| XLogP | 0.82 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |