C13H19NO5S — CID 104933998
(2S)-2-hydroxy-4-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid (PubChem CID 104933998) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 104933998 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2S)-2-hydroxy-4-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC[C@H](O)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-8-6-9(2)12(10(3)7-8)20(18,19)14-5-4-11(15)13(16)17/h6-7,11,14-15H,4-5H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | CZDNDLBLTJRWHM-NSHDSACASA-N |
| XLogP | 0.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |