C12H17NO4S — CID 22801291
(2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 22801291) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 22801291 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C12H17NO4S/c1-7-5-8(2)11(9(3)6-7)18(16,17)13-10(4)12(14)15/h5-6,10,13H,1-4H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | IGEIFKIBAFHEFY-JTQLQIEISA-N |
| XLogP | 1.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |