2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid

C12H17NO5S — CID 43169502

IUPAC2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid
SMILESCOc1cc(C)c(S(=O)(=O)NC(C)C(=O)O)c(C)c1
InChIInChI=1S/C12H17NO5S/c1-7-5-10(18-4)6-8(2)11(7)19(16,17)13-9(3)12(14)15/h5-6,9,13H,1-4H3,(H,14,15)
InChIKeyRHPKXUSHUKCGHH-UHFFFAOYSA-N
MW287.34 g/mol
LogP1.06
Rot. Bonds5

About 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid

2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid (PubChem CID 43169502) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid.

Molecular Properties

Compound Name2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid
PubChem CID43169502
Molecular FormulaC12H17NO5S
Molecular Weight287.34 g/mol
Exact Mass287.08
IUPAC Name2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid
SMILESCOc1cc(C)c(S(=O)(=O)NC(C)C(=O)O)c(C)c1
InChIInChI=1S/C12H17NO5S/c1-7-5-10(18-4)6-8(2)11(7)19(16,17)13-9(3)12(14)15/h5-6,9,13H,1-4H3,(H,14,15)
InChIKeyRHPKXUSHUKCGHH-UHFFFAOYSA-N
XLogP1.06
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.34
LogP ≤ 51.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid?
The IUPAC name of 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid (CID 43169502) is 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid.
What is the SMILES notation for 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid?
The canonical SMILES for 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid is COc1cc(C)c(S(=O)(=O)NC(C)C(=O)O)c(C)c1.
What is the InChIKey of 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid?
The InChIKey is RHPKXUSHUKCGHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5S/c1-7-5-10(18-4)6-8(2)11(7)19(16,17)13-9(3)12(14)15/h5-6,9,13H,1-4H3,(H,14,15).
What are the key properties of 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid?
2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid has a molecular weight of 287.34 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-2,6-dimethylphenyl)sulfonylamino]propanoic acid is sourced from PubChem (CID 43169502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).