C19H25NO3S — CID 133166471
4-methoxy-2,6-dimethyl-N-(4-phenylbutan-2-yl)benzenesulfonamide (PubChem CID 133166471) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-(4-phenylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,6-dimethyl-N-(4-phenylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 133166471 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-(4-phenylbutan-2-yl)benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NC(C)CCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H25NO3S/c1-14-12-18(23-4)13-15(2)19(14)24(21,22)20-16(3)10-11-17-8-6-5-7-9-17/h5-9,12-13,16,20H,10-11H2,1-4H3 |
| InChIKey | KFWJCQRCNPUYKW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |