C18H23NO2S — CID 7777692
2,5-dimethyl-N-[(2R)-4-phenylbutan-2-yl]benzenesulfonamide (PubChem CID 7777692) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(2R)-4-phenylbutan-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[(2R)-4-phenylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7777692 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2,5-dimethyl-N-[(2R)-4-phenylbutan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N[C@H](C)CCc2ccccc2)c1 |
| InChI | InChI=1S/C18H23NO2S/c1-14-9-10-15(2)18(13-14)22(20,21)19-16(3)11-12-17-7-5-4-6-8-17/h4-10,13,16,19H,11-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | JXBJDLVFOFOBRE-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |