C15H25NO2S — CID 53289057
N-(2,4-dimethylpentan-3-yl)-2,5-dimethylbenzenesulfonamide (PubChem CID 53289057) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-yl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(2,4-dimethylpentan-3-yl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 53289057 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(2,4-dimethylpentan-3-yl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C15H25NO2S/c1-10(2)15(11(3)4)16-19(17,18)14-9-12(5)7-8-13(14)6/h7-11,15-16H,1-6H3 |
| InChIKey | LHGACGZDPSFIKB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |