C17H20N2O5S2 — CID 134090359
1,3-bis[(2,5-dimethylphenyl)sulfonyl]urea (PubChem CID 134090359) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1,3-bis[(2,5-dimethylphenyl)sulfonyl]urea.
| Compound Name | 1,3-bis[(2,5-dimethylphenyl)sulfonyl]urea |
|---|---|
| PubChem CID | 134090359 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1,3-bis[(2,5-dimethylphenyl)sulfonyl]urea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(=O)NS(=O)(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-11-5-7-13(3)15(9-11)25(21,22)18-17(20)19-26(23,24)16-10-12(2)6-8-14(16)4/h5-10H,1-4H3,(H2,18,19,20) |
| InChIKey | UTKQJBLKZUOCOA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |