C16H24N2O4S — CID 47052057
6-acetamido-N-(2,5-dimethylphenyl)sulfonylhexanamide (PubChem CID 47052057) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 6-acetamido-N-(2,5-dimethylphenyl)sulfonylhexanamide.
| Compound Name | 6-acetamido-N-(2,5-dimethylphenyl)sulfonylhexanamide |
|---|---|
| PubChem CID | 47052057 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-acetamido-N-(2,5-dimethylphenyl)sulfonylhexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H24N2O4S/c1-12-8-9-13(2)15(11-12)23(21,22)18-16(20)7-5-4-6-10-17-14(3)19/h8-9,11H,4-7,10H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | UTODRAMWTRVXGP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|