C18H31NO2S — CID 19681411
N-decyl-2,5-dimethylbenzenesulfonamide (PubChem CID 19681411) has the molecular formula C18H31NO2S and a molecular weight of 325.52 g/mol. Its IUPAC name is N-decyl-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-decyl-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19681411 |
| Molecular Formula | C18H31NO2S |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | N-decyl-2,5-dimethylbenzenesulfonamide |
| SMILES | CCCCCCCCCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H31NO2S/c1-4-5-6-7-8-9-10-11-14-19-22(20,21)18-15-16(2)12-13-17(18)3/h12-13,15,19H,4-11,14H2,1-3H3 |
| InChIKey | ZZSBSKGXGLQNAS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|