C14H22ClNO2S — CID 19681262
4-chloro-N-hexyl-2,5-dimethylbenzenesulfonamide (PubChem CID 19681262) has the molecular formula C14H22ClNO2S and a molecular weight of 303.86 g/mol. Its IUPAC name is 4-chloro-N-hexyl-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-hexyl-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19681262 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-chloro-N-hexyl-2,5-dimethylbenzenesulfonamide |
| SMILES | CCCCCCNS(=O)(=O)c1cc(C)c(Cl)cc1C |
| InChI | InChI=1S/C14H22ClNO2S/c1-4-5-6-7-8-16-19(17,18)14-10-11(2)13(15)9-12(14)3/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | WUJFZPDXVYKLOF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|