C13H19Cl2NO3S — CID 3830031
2,4-dichloro-5-methyl-N-(3-propoxypropyl)benzenesulfonamide (PubChem CID 3830031) has the molecular formula C13H19Cl2NO3S and a molecular weight of 340.27 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-N-(3-propoxypropyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-methyl-N-(3-propoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3830031 |
| Molecular Formula | C13H19Cl2NO3S |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2,4-dichloro-5-methyl-N-(3-propoxypropyl)benzenesulfonamide |
| SMILES | CCCOCCCNS(=O)(=O)c1cc(C)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO3S/c1-3-6-19-7-4-5-16-20(17,18)13-8-10(2)11(14)9-12(13)15/h8-9,16H,3-7H2,1-2H3 |
| InChIKey | ACOUQSUBWADKRH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|