C11H18BrNO3S2 — CID 82944213
5-bromo-4-methyl-N-(3-propoxypropyl)thiophene-2-sulfonamide (PubChem CID 82944213) has the molecular formula C11H18BrNO3S2 and a molecular weight of 356.31 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(3-propoxypropyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(3-propoxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 82944213 |
| Molecular Formula | C11H18BrNO3S2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 5-bromo-4-methyl-N-(3-propoxypropyl)thiophene-2-sulfonamide |
| SMILES | CCCOCCCNS(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C11H18BrNO3S2/c1-3-6-16-7-4-5-13-18(14,15)10-8-9(2)11(12)17-10/h8,13H,3-7H2,1-2H3 |
| InChIKey | BCIGINQIKJFNHN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|