C11H14BrN3O2S2 — CID 112697586
5-bromo-4-methyl-N-(3-pyrazol-1-ylpropyl)thiophene-2-sulfonamide (PubChem CID 112697586) has the molecular formula C11H14BrN3O2S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(3-pyrazol-1-ylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(3-pyrazol-1-ylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112697586 |
| Molecular Formula | C11H14BrN3O2S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 5-bromo-4-methyl-N-(3-pyrazol-1-ylpropyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCn2cccn2)sc1Br |
| InChI | InChI=1S/C11H14BrN3O2S2/c1-9-8-10(18-11(9)12)19(16,17)14-5-3-7-15-6-2-4-13-15/h2,4,6,8,14H,3,5,7H2,1H3 |
| InChIKey | HCSQHKWWIMSBIE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|