C11H12BrNO2S3 — CID 79931997
5-bromo-4-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide (PubChem CID 79931997) has the molecular formula C11H12BrNO2S3 and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79931997 |
| Molecular Formula | C11H12BrNO2S3 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 5-bromo-4-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCc2cccs2)sc1Br |
| InChI | InChI=1S/C11H12BrNO2S3/c1-8-7-10(17-11(8)12)18(14,15)13-5-4-9-3-2-6-16-9/h2-3,6-7,13H,4-5H2,1H3 |
| InChIKey | RPEQIZAFEBZERC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |