C15H19NO2S2 — CID 3793246
4-propyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 3793246) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 4-propyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-propyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3793246 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-propyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C15H19NO2S2/c1-2-4-13-6-8-15(9-7-13)20(17,18)16-11-10-14-5-3-12-19-14/h3,5-9,12,16H,2,4,10-11H2,1H3 |
| InChIKey | MBIVYAKDWKVBTI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |