C13H16N2O2S2 — CID 18801910
4-(aminomethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 18801910) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18801910 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(aminomethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C13H16N2O2S2/c14-10-11-3-5-13(6-4-11)19(16,17)15-8-7-12-2-1-9-18-12/h1-6,9,15H,7-8,10,14H2 |
| InChIKey | WVZYLUDLGMTNDY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |