C10H13BrN4O2S2 — CID 79945818
5-bromo-4-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide (PubChem CID 79945818) has the molecular formula C10H13BrN4O2S2 and a molecular weight of 365.28 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79945818 |
| Molecular Formula | C10H13BrN4O2S2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 5-bromo-4-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCc2ncn[nH]2)sc1Br |
| InChI | InChI=1S/C10H13BrN4O2S2/c1-7-5-9(18-10(7)11)19(16,17)14-4-2-3-8-12-6-13-15-8/h5-6,14H,2-4H2,1H3,(H,12,13,15) |
| InChIKey | JCKWTWMWRISVRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|