C10H15N5O2S2 — CID 64531762
5-(aminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide (PubChem CID 64531762) has the molecular formula C10H15N5O2S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 64531762 |
| Molecular Formula | C10H15N5O2S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(aminomethyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]thiophene-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCCc2ncn[nH]2)s1 |
| InChI | InChI=1S/C10H15N5O2S2/c11-6-8-3-4-10(18-8)19(16,17)14-5-1-2-9-12-7-13-15-9/h3-4,7,14H,1-2,5-6,11H2,(H,12,13,15) |
| InChIKey | YPFFZPPGYUCCSQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|