C12H15N5O2S2 — CID 64529596
4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]benzenecarbothioamide (PubChem CID 64529596) has the molecular formula C12H15N5O2S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]benzenecarbothioamide.
| Compound Name | 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64529596 |
| Molecular Formula | C12H15N5O2S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-[3-(1H-1,2,4-triazol-5-yl)propylsulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H15N5O2S2/c13-12(20)9-3-5-10(6-4-9)21(18,19)16-7-1-2-11-14-8-15-17-11/h3-6,8,16H,1-2,7H2,(H2,13,20)(H,14,15,17) |
| InChIKey | IQHSGYPBCMDIHM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|