C11H13N5O2S2 — CID 64530384
4-(1H-1,2,4-triazol-5-ylmethylsulfamoylmethyl)benzenecarbothioamide (PubChem CID 64530384) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylmethylsulfamoylmethyl)benzenecarbothioamide.
| Compound Name | 4-(1H-1,2,4-triazol-5-ylmethylsulfamoylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 64530384 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylmethylsulfamoylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CS(=O)(=O)NCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C11H13N5O2S2/c12-11(19)9-3-1-8(2-4-9)6-20(17,18)15-5-10-13-7-14-16-10/h1-4,7,15H,5-6H2,(H2,12,19)(H,13,14,16) |
| InChIKey | MNIBQYGPLFRBLJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|