C10H11N5O3S — CID 54883543
4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzamide (PubChem CID 54883543) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 54883543 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H11N5O3S/c11-10(16)7-1-3-8(4-2-7)19(17,18)14-5-9-12-6-13-15-9/h1-4,6,14H,5H2,(H2,11,16)(H,12,13,15) |
| InChIKey | OYCMPSSCKAEBOQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |